C10H14N2O2 — CID 143034204
2-[(3S)-oxolan-3-yl]oxybenzene-1,4-diamine (PubChem CID 143034204) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-[(3S)-oxolan-3-yl]oxybenzene-1,4-diamine.
| Compound Name | 2-[(3S)-oxolan-3-yl]oxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 143034204 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-[(3S)-oxolan-3-yl]oxybenzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(O[C@H]2CCOC2)c1 |
| InChI | InChI=1S/C10H14N2O2/c11-7-1-2-9(12)10(5-7)14-8-3-4-13-6-8/h1-2,5,8H,3-4,6,11-12H2/t8-/m0/s1 |
| InChIKey | CCAYZMLOZPTZSP-QMMMGPOBSA-N |
| XLogP | 1.02 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|