C22H20N2O6 — CID 143034599
methyl 3-[(1E,3Z,5Z)-5-[5-cyano-1-(2-hydroxyethyl)-4-methyl-2,6-dioxo-3-pyridinylidene]-4-hydroxypenta-1,3-dienyl]benzoate (PubChem CID 143034599) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is methyl 3-[(1E,3Z,5Z)-5-[5-cyano-1-(2-hydroxyethyl)-4-methyl-2,6-dioxo-3-pyridinylidene]-4-hydroxypenta-1,3-dienyl]benzoate.
| Compound Name | methyl 3-[(1E,3Z,5Z)-5-[5-cyano-1-(2-hydroxyethyl)-4-methyl-2,6-dioxo-3-pyridinylidene]-4-hydroxypenta-1,3-dienyl]benzoate |
|---|---|
| PubChem CID | 143034599 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | methyl 3-[(1E,3Z,5Z)-5-[5-cyano-1-(2-hydroxyethyl)-4-methyl-2,6-dioxo-3-pyridinylidene]-4-hydroxypenta-1,3-dienyl]benzoate |
| SMILES | COC(=O)c1cccc(/C=C/C=C(O)/C=C2\C(=O)N(CCO)C(=O)C(C#N)=C2C)c1 |
| InChI | InChI=1S/C22H20N2O6/c1-14-18(20(27)24(9-10-25)21(28)19(14)13-23)12-17(26)8-4-6-15-5-3-7-16(11-15)22(29)30-2/h3-8,11-12,25-26H,9-10H2,1-2H3/b6-4+,17-8-,18-12- |
| InChIKey | QPJVEZYIOIGHMD-DAPCEJIESA-N |
| XLogP | 2.06 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|