C20H27N3O3S — CID 143034619
(2Z,4Z,6E)-3-ethoxyocta-2,4,6-trien-2-ol;3-methyl-4H-1,4-benzothiazine-2-carbohydrazide (PubChem CID 143034619) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is (2Z,4Z,6E)-3-ethoxyocta-2,4,6-trien-2-ol;3-methyl-4H-1,4-benzothiazine-2-carbohydrazide.
| Compound Name | (2Z,4Z,6E)-3-ethoxyocta-2,4,6-trien-2-ol;3-methyl-4H-1,4-benzothiazine-2-carbohydrazide |
|---|---|
| PubChem CID | 143034619 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2Z,4Z,6E)-3-ethoxyocta-2,4,6-trien-2-ol;3-methyl-4H-1,4-benzothiazine-2-carbohydrazide |
| SMILES | C/C=C/C=C\C(OCC)=C(/C)O.CC1=C(C(=O)NN)Sc2ccccc2N1 |
| InChI | InChI=1S/C10H11N3OS.C10H16O2/c1-6-9(10(14)13-11)15-8-5-3-2-4-7(8)12-6;1-4-6-7-8-10(9(3)11)12-5-2/h2-5,12H,11H2,1H3,(H,13,14);4,6-8,11H,5H2,1-3H3/b;6-4+,8-7-,10-9- |
| InChIKey | KQQDVUKWYHNITL-ANMZCAEUSA-N |
| XLogP | 4.37 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|