About 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene
2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene (PubChem CID 143034923) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene |
| PubChem CID | 143034923 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene |
| SMILES | CC1=C(OC(C)C)CC=CC=C1 |
| InChI | InChI=1S/C11H16O/c1-9(2)12-11-8-6-4-5-7-10(11)3/h4-7,9H,8H2,1-3H3 |
| InChIKey | TWLWIYNIOWIMML-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene?
The IUPAC name of 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene (CID 143034923) is 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene.
What is the SMILES notation for 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene?
The canonical SMILES for 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene is CC1=C(OC(C)C)CC=CC=C1.
What is the InChIKey of 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene?
The InChIKey is TWLWIYNIOWIMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-9(2)12-11-8-6-4-5-7-10(11)3/h4-7,9H,8H2,1-3H3.
What are the key properties of 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene?
2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene has a molecular weight of 164.25 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene is sourced from PubChem (CID 143034923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).