C36H49FO4 — CID 143036229
(Z)-4-[(Z)-3-[6-[(2Z,5E,7Z)-5-ethenyl-3-(2-ethylbut-1-enyl)-4-methylnona-2,5,7-trien-2-yl]oxy-3-fluorocyclohepta-1,3,6-trien-1-yl]oxyprop-1-enyl]-5-methylhept-4-enoic acid (PubChem CID 143036229) has the molecular formula C36H49FO4 and a molecular weight of 564.78 g/mol. Its IUPAC name is (Z)-4-[(Z)-3-[6-[(2Z,5E,7Z)-5-ethenyl-3-(2-ethylbut-1-enyl)-4-methylnona-2,5,7-trien-2-yl]oxy-3-fluorocyclohepta-1,3,6-trien-1-yl]oxyprop-1-enyl]-5-methylhept-4-enoic acid.
| Compound Name | (Z)-4-[(Z)-3-[6-[(2Z,5E,7Z)-5-ethenyl-3-(2-ethylbut-1-enyl)-4-methylnona-2,5,7-trien-2-yl]oxy-3-fluorocyclohepta-1,3,6-trien-1-yl]oxyprop-1-enyl]-5-methylhept-4-enoic acid |
|---|---|
| PubChem CID | 143036229 |
| Molecular Formula | C36H49FO4 |
| Molecular Weight | 564.78 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | (Z)-4-[(Z)-3-[6-[(2Z,5E,7Z)-5-ethenyl-3-(2-ethylbut-1-enyl)-4-methylnona-2,5,7-trien-2-yl]oxy-3-fluorocyclohepta-1,3,6-trien-1-yl]oxyprop-1-enyl]-5-methylhept-4-enoic acid |
| SMILES | C=C/C(=C\C=C/C)C(C)/C(C=C(CC)CC)=C(/C)OC1=CC(OC/C=C\C(CCC(=O)O)=C(\C)CC)=CC(F)=CC1 |
| InChI | InChI=1S/C36H49FO4/c1-9-14-16-30(13-5)27(7)35(23-29(11-3)12-4)28(8)41-33-20-19-32(37)24-34(25-33)40-22-15-17-31(26(6)10-2)18-21-36(38)39/h9,13-17,19,23-25,27H,5,10-12,18,20-22H2,1-4,6-8H3,(H,38,39)/b14-9-,17-15-,30-16+,31-26+,35-28- |
| InChIKey | DGHDYEPWEOVLLX-HYLOWIDCSA-N |
| XLogP | 10.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.78 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|