C20H22F3N3O2S — CID 143036338
(2E,4E)-5-[1-ethyl-4-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]hepta-2,4,6-triene-2-sulfonamide (PubChem CID 143036338) has the molecular formula C20H22F3N3O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is (2E,4E)-5-[1-ethyl-4-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]hepta-2,4,6-triene-2-sulfonamide.
| Compound Name | (2E,4E)-5-[1-ethyl-4-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]hepta-2,4,6-triene-2-sulfonamide |
|---|---|
| PubChem CID | 143036338 |
| Molecular Formula | C20H22F3N3O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (2E,4E)-5-[1-ethyl-4-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]hepta-2,4,6-triene-2-sulfonamide |
| SMILES | C=C/C(=C\C=C(/C)S(N)(=O)=O)c1nn(CC)c(C(F)(F)F)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22F3N3O2S/c1-5-15(12-9-14(4)29(24,27)28)18-17(16-10-7-13(3)8-11-16)19(20(21,22)23)26(6-2)25-18/h5,7-12H,1,6H2,2-4H3,(H2,24,27,28)/b14-9+,15-12+ |
| InChIKey | SEYOSPSNJGOTSU-WKDANBKTSA-N |
| XLogP | 4.66 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|