C20H20O7 — CID 143036389
6H-cyclohepta[c]furan-1,3-dione;(3E,4E)-3-ethylidene-4-prop-2-enylideneoxolane-2,5-dione;methoxymethane (PubChem CID 143036389) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 6H-cyclohepta[c]furan-1,3-dione;(3E,4E)-3-ethylidene-4-prop-2-enylideneoxolane-2,5-dione;methoxymethane.
| Compound Name | 6H-cyclohepta[c]furan-1,3-dione;(3E,4E)-3-ethylidene-4-prop-2-enylideneoxolane-2,5-dione;methoxymethane |
|---|---|
| PubChem CID | 143036389 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 6H-cyclohepta[c]furan-1,3-dione;(3E,4E)-3-ethylidene-4-prop-2-enylideneoxolane-2,5-dione;methoxymethane |
| SMILES | C=C/C=C1/C(=O)OC(=O)/C1=C/C.COC.O=C1OC(=O)C2=C1C=CCC=C2 |
| InChI | InChI=1S/C9H6O3.C9H8O3.C2H6O/c10-8-6-4-2-1-3-5-7(6)9(11)12-8;1-3-5-7-6(4-2)8(10)12-9(7)11;1-3-2/h2-5H,1H2;3-5H,1H2,2H3;1-2H3/b;6-4+,7-5+; |
| InChIKey | LVUOVYWWHDNCNI-NNBDHBSNSA-N |
| XLogP | 2.27 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|