C12H25N3O — CID 143036445
ethane;1-[6-(methylamino)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-3-yl]ethanone (PubChem CID 143036445) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is ethane;1-[6-(methylamino)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-3-yl]ethanone.
| Compound Name | ethane;1-[6-(methylamino)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 143036445 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | ethane;1-[6-(methylamino)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-3-yl]ethanone |
| SMILES | CC.CNC1CCC2NCC(C(C)=O)N2C1 |
| InChI | InChI=1S/C10H19N3O.C2H6/c1-7(14)9-5-12-10-4-3-8(11-2)6-13(9)10;1-2/h8-12H,3-6H2,1-2H3;1-2H3 |
| InChIKey | MXGVNDDWKJLGGF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |