C21H21IN2O2 — CID 143036531
4-(1-iodo-5-methylpyrrolidin-3-yl)oxy-7-methoxy-2-phenylquinoline (PubChem CID 143036531) has the molecular formula C21H21IN2O2 and a molecular weight of 460.32 g/mol. Its IUPAC name is 4-(1-iodo-5-methylpyrrolidin-3-yl)oxy-7-methoxy-2-phenylquinoline.
| Compound Name | 4-(1-iodo-5-methylpyrrolidin-3-yl)oxy-7-methoxy-2-phenylquinoline |
|---|---|
| PubChem CID | 143036531 |
| Molecular Formula | C21H21IN2O2 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 4-(1-iodo-5-methylpyrrolidin-3-yl)oxy-7-methoxy-2-phenylquinoline |
| SMILES | COc1ccc2c(OC3CC(C)N(I)C3)cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C21H21IN2O2/c1-14-10-17(13-24(14)22)26-21-12-19(15-6-4-3-5-7-15)23-20-11-16(25-2)8-9-18(20)21/h3-9,11-12,14,17H,10,13H2,1-2H3 |
| InChIKey | SIHGCQXSLQAIMT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|