C23H37ClN2OS — CID 143036735
1-[(E,3Z)-6-chloro-4-methylidene-1-piperazin-1-yl-3-(prop-2-enylsulfanylmethylidene)oct-5-en-2-yl]cyclohexan-1-ol (PubChem CID 143036735) has the molecular formula C23H37ClN2OS and a molecular weight of 425.08 g/mol. Its IUPAC name is 1-[(E,3Z)-6-chloro-4-methylidene-1-piperazin-1-yl-3-(prop-2-enylsulfanylmethylidene)oct-5-en-2-yl]cyclohexan-1-ol.
| Compound Name | 1-[(E,3Z)-6-chloro-4-methylidene-1-piperazin-1-yl-3-(prop-2-enylsulfanylmethylidene)oct-5-en-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143036735 |
| Molecular Formula | C23H37ClN2OS |
| Molecular Weight | 425.08 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[(E,3Z)-6-chloro-4-methylidene-1-piperazin-1-yl-3-(prop-2-enylsulfanylmethylidene)oct-5-en-2-yl]cyclohexan-1-ol |
| SMILES | C=CCS/C=C(\C(=C)/C=C(/Cl)CC)C(CN1CCNCC1)C1(O)CCCCC1 |
| InChI | InChI=1S/C23H37ClN2OS/c1-4-15-28-18-21(19(3)16-20(24)5-2)22(17-26-13-11-25-12-14-26)23(27)9-7-6-8-10-23/h4,16,18,22,25,27H,1,3,5-15,17H2,2H3/b20-16+,21-18+ |
| InChIKey | KOOHNRYYLWGCIQ-OBPCBVSQSA-N |
| XLogP | 5.09 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.08 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|