C27H38N2O2 — CID 143036775
1-[2-[3-(methylamino)piperidin-1-yl]-1-(4-phenylmethoxyphenyl)ethyl]cyclohexan-1-ol (PubChem CID 143036775) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is 1-[2-[3-(methylamino)piperidin-1-yl]-1-(4-phenylmethoxyphenyl)ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[3-(methylamino)piperidin-1-yl]-1-(4-phenylmethoxyphenyl)ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143036775 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 1-[2-[3-(methylamino)piperidin-1-yl]-1-(4-phenylmethoxyphenyl)ethyl]cyclohexan-1-ol |
| SMILES | CNC1CCCN(CC(c2ccc(OCc3ccccc3)cc2)C2(O)CCCCC2)C1 |
| InChI | InChI=1S/C27H38N2O2/c1-28-24-11-8-18-29(19-24)20-26(27(30)16-6-3-7-17-27)23-12-14-25(15-13-23)31-21-22-9-4-2-5-10-22/h2,4-5,9-10,12-15,24,26,28,30H,3,6-8,11,16-21H2,1H3 |
| InChIKey | PTPGSUFPFNDQJD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |