C33H53N — CID 143036833
1-[(3E,5Z,9Z,11Z)-3,9-bis(ethenyl)-2-(1-methylcycloheptyl)-6-propan-2-yltrideca-3,5,9,11-tetraenyl]piperidine (PubChem CID 143036833) has the molecular formula C33H53N and a molecular weight of 463.79 g/mol. Its IUPAC name is 1-[(3E,5Z,9Z,11Z)-3,9-bis(ethenyl)-2-(1-methylcycloheptyl)-6-propan-2-yltrideca-3,5,9,11-tetraenyl]piperidine.
| Compound Name | 1-[(3E,5Z,9Z,11Z)-3,9-bis(ethenyl)-2-(1-methylcycloheptyl)-6-propan-2-yltrideca-3,5,9,11-tetraenyl]piperidine |
|---|---|
| PubChem CID | 143036833 |
| Molecular Formula | C33H53N |
| Molecular Weight | 463.79 g/mol |
| Exact Mass | 463.42 |
| IUPAC Name | 1-[(3E,5Z,9Z,11Z)-3,9-bis(ethenyl)-2-(1-methylcycloheptyl)-6-propan-2-yltrideca-3,5,9,11-tetraenyl]piperidine |
| SMILES | C=C/C(=C\C=C/C)CC/C(=C/C=C(\C=C)C(CN1CCCCC1)C1(C)CCCCCC1)C(C)C |
| InChI | InChI=1S/C33H53N/c1-7-10-18-29(8-2)19-20-31(28(4)5)22-21-30(9-3)32(27-34-25-16-13-17-26-34)33(6)23-14-11-12-15-24-33/h7-10,18,21-22,28,32H,2-3,11-17,19-20,23-27H2,1,4-6H3/b10-7-,29-18+,30-21+,31-22- |
| InChIKey | NLLRMOSHAJUWMY-SIUPKBADSA-N |
| XLogP | 9.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.79 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|