About 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide
4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide (PubChem CID 143036908) has the molecular formula C20H33N3O2S
and a molecular weight of 379.57 g/mol. Its IUPAC name is 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide.
Molecular Properties
| Compound Name | 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide |
| PubChem CID | 143036908 |
| Molecular Formula | C20H33N3O2S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide |
| SMILES | O=C(CCCN(CCCC1CCCCC1)C(=O)NC1=CCCC=C1)NS |
| InChI | InChI=1S/C20H33N3O2S/c24-19(22-26)14-8-16-23(15-7-11-17-9-3-1-4-10-17)20(25)21-18-12-5-2-6-13-18/h5,12-13,17,26H,1-4,6-11,14-16H2,(H,21,25)(H,22,24) |
| InChIKey | SKBWTEIIHSXAER-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide?
The IUPAC name of 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide (CID 143036908) is 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide.
What is the SMILES notation for 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide?
The canonical SMILES for 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide is O=C(CCCN(CCCC1CCCCC1)C(=O)NC1=CCCC=C1)NS.
What is the InChIKey of 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide?
The InChIKey is SKBWTEIIHSXAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N3O2S/c24-19(22-26)14-8-16-23(15-7-11-17-9-3-1-4-10-17)20(25)21-18-12-5-2-6-13-18/h5,12-13,17,26H,1-4,6-11,14-16H2,(H,21,25)(H,22,24).
What are the key properties of 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide?
4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide has a molecular weight of 379.57 g/mol, XLogP of 4.33, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[cyclohexa-1,5-dien-1-ylcarbamoyl(3-cyclohexylpropyl)amino]-N-sulfanylbutanamide is sourced from PubChem (CID 143036908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).