C20H20N5OS2- — CID 143037182
3-[[4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenethiolate (PubChem CID 143037182) has the molecular formula C20H20N5OS2- and a molecular weight of 410.55 g/mol. Its IUPAC name is 3-[[4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenethiolate.
| Compound Name | 3-[[4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenethiolate |
|---|---|
| PubChem CID | 143037182 |
| Molecular Formula | C20H20N5OS2- |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-[[4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenethiolate |
| SMILES | [S-]c1cccc(Nc2ncc3c(n2)-c2cc(CN4CCNCC4)sc2CO3)c1 |
| InChI | InChI=1S/C20H21N5OS2/c27-14-3-1-2-13(8-14)23-20-22-10-17-19(24-20)16-9-15(28-18(16)12-26-17)11-25-6-4-21-5-7-25/h1-3,8-10,21,27H,4-7,11-12H2,(H,22,23,24)/p-1 |
| InChIKey | DFYPPLUBJRCQPC-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|