About 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride
3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride (PubChem CID 143037401) has the molecular formula C6H4ClNO3S
and a molecular weight of 205.62 g/mol. Its IUPAC name is 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride |
| PubChem CID | 143037401 |
| Molecular Formula | C6H4ClNO3S |
| Molecular Weight | 205.62 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride |
| SMILES | [H]/N=C1\C=C(S(=O)(=O)Cl)C=CC1=O |
| InChI | InChI=1S/C6H4ClNO3S/c7-12(10,11)4-1-2-6(9)5(8)3-4/h1-3,8H/b8-5+ |
| InChIKey | AIWZETMRRGVFAN-VMPITWQZSA-N |
| XLogP | 0.60 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.62 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride?
The IUPAC name of 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride (CID 143037401) is 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride.
What is the SMILES notation for 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride?
The canonical SMILES for 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride is [H]/N=C1\C=C(S(=O)(=O)Cl)C=CC1=O.
What is the InChIKey of 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride?
The InChIKey is AIWZETMRRGVFAN-VMPITWQZSA-N. The full InChI is InChI=1S/C6H4ClNO3S/c7-12(10,11)4-1-2-6(9)5(8)3-4/h1-3,8H/b8-5+.
What are the key properties of 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride?
3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride has a molecular weight of 205.62 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonyl chloride is sourced from PubChem (CID 143037401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).