C15H16N6O2 — CID 143037444
(Z)-3-[(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)amino]prop-2-enimidamide (PubChem CID 143037444) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is (Z)-3-[(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)amino]prop-2-enimidamide.
| Compound Name | (Z)-3-[(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)amino]prop-2-enimidamide |
|---|---|
| PubChem CID | 143037444 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (Z)-3-[(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)amino]prop-2-enimidamide |
| SMILES | [H]/N=C(N)/C=C\Nc1ncnc2[nH]c3cc(OC)c(OC)cc3c12 |
| InChI | InChI=1S/C15H16N6O2/c1-22-10-5-8-9(6-11(10)23-2)21-15-13(8)14(19-7-20-15)18-4-3-12(16)17/h3-7H,1-2H3,(H3,16,17)(H2,18,19,20,21)/b4-3- |
| InChIKey | OKECBCJIWYWHFL-ARJAWSKDSA-N |
| XLogP | 1.99 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|