About ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate
ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate (PubChem CID 143037585) has the molecular formula C9H12ClNO4
and a molecular weight of 233.65 g/mol. Its IUPAC name is ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate.
Molecular Properties
| Compound Name | ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate |
| PubChem CID | 143037585 |
| Molecular Formula | C9H12ClNO4 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate |
| SMILES | CC.O=C(Cl)OC1=CC=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C7H6ClNO4.C2H6/c8-7(10)13-6-3-1-5(2-4-6)9(11)12;1-2/h1,3H,2,4H2;1-2H3 |
| InChIKey | AGLRODIEHSQWIE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate?
The IUPAC name of ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate (CID 143037585) is ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate.
What is the SMILES notation for ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate?
The canonical SMILES for ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate is CC.O=C(Cl)OC1=CC=C([N+](=O)[O-])CC1.
What is the InChIKey of ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate?
The InChIKey is AGLRODIEHSQWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO4.C2H6/c8-7(10)13-6-3-1-5(2-4-6)9(11)12;1-2/h1,3H,2,4H2;1-2H3.
What are the key properties of ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate?
ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate has a molecular weight of 233.65 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-nitrocyclohexa-1,3-dien-1-yl) carbonochloridate is sourced from PubChem (CID 143037585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).