C23H30ClN5O2 — CID 143038736
1-chloro-3-methylbenzene;1-[2-(ethylamino)ethyl]-6-methyl-3-(2-pyridin-2-yloxyethylamino)pyrazin-2-one (PubChem CID 143038736) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is 1-chloro-3-methylbenzene;1-[2-(ethylamino)ethyl]-6-methyl-3-(2-pyridin-2-yloxyethylamino)pyrazin-2-one.
| Compound Name | 1-chloro-3-methylbenzene;1-[2-(ethylamino)ethyl]-6-methyl-3-(2-pyridin-2-yloxyethylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 143038736 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-chloro-3-methylbenzene;1-[2-(ethylamino)ethyl]-6-methyl-3-(2-pyridin-2-yloxyethylamino)pyrazin-2-one |
| SMILES | CCNCCn1c(C)cnc(NCCOc2ccccn2)c1=O.Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H23N5O2.C7H7Cl/c1-3-17-8-10-21-13(2)12-20-15(16(21)22)19-9-11-23-14-6-4-5-7-18-14;1-6-3-2-4-7(8)5-6/h4-7,12,17H,3,8-11H2,1-2H3,(H,19,20);2-5H,1H3 |
| InChIKey | TXQUYRSFFBNICR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|