C36H40N2 — CID 143038916
N-(3-bicyclo[4.1.0]hepta-2,4-dienyl)-1-cyclohexa-1,3-dien-1-yl-1-[4-(cyclohexa-2,4-dien-1-ylmethyl)phenyl]methanimine;N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine (PubChem CID 143038916) has the molecular formula C36H40N2 and a molecular weight of 500.73 g/mol. Its IUPAC name is N-(3-bicyclo[4.1.0]hepta-2,4-dienyl)-1-cyclohexa-1,3-dien-1-yl-1-[4-(cyclohexa-2,4-dien-1-ylmethyl)phenyl]methanimine;N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine.
| Compound Name | N-(3-bicyclo[4.1.0]hepta-2,4-dienyl)-1-cyclohexa-1,3-dien-1-yl-1-[4-(cyclohexa-2,4-dien-1-ylmethyl)phenyl]methanimine;N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 143038916 |
| Molecular Formula | C36H40N2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | N-(3-bicyclo[4.1.0]hepta-2,4-dienyl)-1-cyclohexa-1,3-dien-1-yl-1-[4-(cyclohexa-2,4-dien-1-ylmethyl)phenyl]methanimine;N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine |
| SMILES | C1=CCCC(/C(=N\C2=CC3CC3C=C2)c2ccc(CC3C=CC=CC3)cc2)=C1.CN(C)C1=CC2CC2C=C1 |
| InChI | InChI=1S/C27H27N.C9H13N/c1-3-7-20(8-4-1)17-21-11-13-23(14-12-21)27(22-9-5-2-6-10-22)28-26-16-15-24-18-25(24)19-26;1-10(2)9-4-3-7-5-8(7)6-9/h1-5,7,9,11-16,19-20,24-25H,6,8,10,17-18H2;3-4,6-8H,5H2,1-2H3/b28-27+; |
| InChIKey | JYBXGMGFGISDOW-RXQWRGDBSA-N |
| XLogP | 8.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|