C26H32ClNS — CID 143039070
(1Z,3E)-1-(3-chlorophenyl)-2,3-bis(ethenyl)-N-methyl-4-(4-methylphenyl)-N-methylsulfanylpenta-1,3-dien-1-amine;ethane (PubChem CID 143039070) has the molecular formula C26H32ClNS and a molecular weight of 426.07 g/mol. Its IUPAC name is (1Z,3E)-1-(3-chlorophenyl)-2,3-bis(ethenyl)-N-methyl-4-(4-methylphenyl)-N-methylsulfanylpenta-1,3-dien-1-amine;ethane.
| Compound Name | (1Z,3E)-1-(3-chlorophenyl)-2,3-bis(ethenyl)-N-methyl-4-(4-methylphenyl)-N-methylsulfanylpenta-1,3-dien-1-amine;ethane |
|---|---|
| PubChem CID | 143039070 |
| Molecular Formula | C26H32ClNS |
| Molecular Weight | 426.07 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (1Z,3E)-1-(3-chlorophenyl)-2,3-bis(ethenyl)-N-methyl-4-(4-methylphenyl)-N-methylsulfanylpenta-1,3-dien-1-amine;ethane |
| SMILES | C=CC(=C(C)c1ccc(C)cc1)/C(C=C)=C(/c1cccc(Cl)c1)N(C)SC.CC |
| InChI | InChI=1S/C24H26ClNS.C2H6/c1-7-22(18(4)19-14-12-17(3)13-15-19)23(8-2)24(26(5)27-6)20-10-9-11-21(25)16-20;1-2/h7-16H,1-2H2,3-6H3;1-2H3/b22-18+,24-23-; |
| InChIKey | DZMKVWWQFVWOKX-HPXGJSDBSA-N |
| XLogP | 8.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.07 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|