C23H25N3O6 — CID 143039084
1,4-diamino-3-formyl-N-[3-(2-methoxyethoxy)propyl]-N-methyl-9,10-dioxoanthracene-2-carboxamide (PubChem CID 143039084) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is 1,4-diamino-3-formyl-N-[3-(2-methoxyethoxy)propyl]-N-methyl-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | 1,4-diamino-3-formyl-N-[3-(2-methoxyethoxy)propyl]-N-methyl-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 143039084 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1,4-diamino-3-formyl-N-[3-(2-methoxyethoxy)propyl]-N-methyl-9,10-dioxoanthracene-2-carboxamide |
| SMILES | COCCOCCCN(C)C(=O)c1c(N)c2c(c(N)c1C=O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H25N3O6/c1-26(8-5-9-32-11-10-31-2)23(30)16-15(12-27)19(24)17-18(20(16)25)22(29)14-7-4-3-6-13(14)21(17)28/h3-4,6-7,12H,5,8-11,24-25H2,1-2H3 |
| InChIKey | CTYIJXAUGDDDRR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|