About 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid
4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid (PubChem CID 143039139) has the molecular formula C11H9Cl2NO6S2
and a molecular weight of 386.23 g/mol. Its IUPAC name is 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid.
Molecular Properties
| Compound Name | 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid |
| PubChem CID | 143039139 |
| Molecular Formula | C11H9Cl2NO6S2 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 384.92 |
| IUPAC Name | 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid |
| SMILES | O=S(=O)(Cl)c1ccc(Oc2ccccn2)cc1.O=S(=O)(O)Cl |
| InChI | InChI=1S/C11H8ClNO3S.ClHO3S/c12-17(14,15)10-6-4-9(5-7-10)16-11-3-1-2-8-13-11;1-5(2,3)4/h1-8H;(H,2,3,4) |
| InChIKey | RTXGFWPCNSLDBR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid?
The IUPAC name of 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid (CID 143039139) is 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid.
What is the SMILES notation for 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid?
The canonical SMILES for 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid is O=S(=O)(Cl)c1ccc(Oc2ccccn2)cc1.O=S(=O)(O)Cl.
What is the InChIKey of 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid?
The InChIKey is RTXGFWPCNSLDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO3S.ClHO3S/c12-17(14,15)10-6-4-9(5-7-10)16-11-3-1-2-8-13-11;1-5(2,3)4/h1-8H;(H,2,3,4).
What are the key properties of 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid?
4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid has a molecular weight of 386.23 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-2-yloxybenzenesulfonyl chloride;sulfurochloridic acid is sourced from PubChem (CID 143039139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).