About ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol
ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol (PubChem CID 143039478) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol.
Molecular Properties
| Compound Name | ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol |
| PubChem CID | 143039478 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol |
| SMILES | CC.CC(C)O.COc1cc2c(cn1)N(C=O)CC2 |
| InChI | InChI=1S/C9H10N2O2.C3H8O.C2H6/c1-13-9-4-7-2-3-11(6-12)8(7)5-10-9;1-3(2)4;1-2/h4-6H,2-3H2,1H3;3-4H,1-2H3;1-2H3 |
| InChIKey | YVTKXKSKSVJWNB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol?
The IUPAC name of ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol (CID 143039478) is ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol.
What is the SMILES notation for ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol?
The canonical SMILES for ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol is CC.CC(C)O.COc1cc2c(cn1)N(C=O)CC2.
What is the InChIKey of ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol?
The InChIKey is YVTKXKSKSVJWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2.C3H8O.C2H6/c1-13-9-4-7-2-3-11(6-12)8(7)5-10-9;1-3(2)4;1-2/h4-6H,2-3H2,1H3;3-4H,1-2H3;1-2H3.
What are the key properties of ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol?
ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol has a molecular weight of 268.36 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methoxy-2,3-dihydropyrrolo[2,3-c]pyridine-1-carbaldehyde;propan-2-ol is sourced from PubChem (CID 143039478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).