C25H38N2O — CID 143040740
N-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methyl]-N-[(1E,3E)-penta-1,3-dienyl]-2,3,4,7-tetrahydro-1H-azepin-5-amine;(Z)-pent-2-ene (PubChem CID 143040740) has the molecular formula C25H38N2O and a molecular weight of 382.59 g/mol. Its IUPAC name is N-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methyl]-N-[(1E,3E)-penta-1,3-dienyl]-2,3,4,7-tetrahydro-1H-azepin-5-amine;(Z)-pent-2-ene.
| Compound Name | N-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methyl]-N-[(1E,3E)-penta-1,3-dienyl]-2,3,4,7-tetrahydro-1H-azepin-5-amine;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 143040740 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | N-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methyl]-N-[(1E,3E)-penta-1,3-dienyl]-2,3,4,7-tetrahydro-1H-azepin-5-amine;(Z)-pent-2-ene |
| SMILES | C/C=C/C=C/N(CC1=CCC=C(OC)C=C1)C1=CCNCCC1.C/C=C\CC |
| InChI | InChI=1S/C20H28N2O.C5H10/c1-3-4-5-16-22(19-9-7-14-21-15-13-19)17-18-8-6-10-20(23-2)12-11-18;1-3-5-4-2/h3-5,8,10-13,16,21H,6-7,9,14-15,17H2,1-2H3;3,5H,4H2,1-2H3/b4-3+,16-5+;5-3- |
| InChIKey | QTTCYQKNGUOMHC-KCNWHGPVSA-N |
| XLogP | 6.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|