C22H25ClFN3O — CID 143040746
4-[[3-[(2E)-6-chloroocta-2,4,7-trien-2-yl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-d]azepin-2-yl]methyl]-2-fluorophenol (PubChem CID 143040746) has the molecular formula C22H25ClFN3O and a molecular weight of 401.91 g/mol. Its IUPAC name is 4-[[3-[(2E)-6-chloroocta-2,4,7-trien-2-yl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-d]azepin-2-yl]methyl]-2-fluorophenol.
| Compound Name | 4-[[3-[(2E)-6-chloroocta-2,4,7-trien-2-yl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-d]azepin-2-yl]methyl]-2-fluorophenol |
|---|---|
| PubChem CID | 143040746 |
| Molecular Formula | C22H25ClFN3O |
| Molecular Weight | 401.91 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-[[3-[(2E)-6-chloroocta-2,4,7-trien-2-yl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-d]azepin-2-yl]methyl]-2-fluorophenol |
| SMILES | C=CC(Cl)C=C/C=C(\C)c1c2c(nn1Cc1ccc(O)c(F)c1)CCNCC2 |
| InChI | InChI=1S/C22H25ClFN3O/c1-3-17(23)6-4-5-15(2)22-18-9-11-25-12-10-20(18)26-27(22)14-16-7-8-21(28)19(24)13-16/h3-8,13,17,25,28H,1,9-12,14H2,2H3/b6-4?,15-5+ |
| InChIKey | LNEYIKHMLJMLFQ-DERRZNSPSA-N |
| XLogP | 4.22 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|