C22H35FN6O2 — CID 143040922
2-amino-N-(3-imidazol-1-ylpropyl)-2-prop-1-en-2-yliminoacetamide;O-[(1Z,5E,7Z)-6-fluoro-4-methyldeca-1,5,7-trienyl]hydroxylamine (PubChem CID 143040922) has the molecular formula C22H35FN6O2 and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-amino-N-(3-imidazol-1-ylpropyl)-2-prop-1-en-2-yliminoacetamide;O-[(1Z,5E,7Z)-6-fluoro-4-methyldeca-1,5,7-trienyl]hydroxylamine.
| Compound Name | 2-amino-N-(3-imidazol-1-ylpropyl)-2-prop-1-en-2-yliminoacetamide;O-[(1Z,5E,7Z)-6-fluoro-4-methyldeca-1,5,7-trienyl]hydroxylamine |
|---|---|
| PubChem CID | 143040922 |
| Molecular Formula | C22H35FN6O2 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 2-amino-N-(3-imidazol-1-ylpropyl)-2-prop-1-en-2-yliminoacetamide;O-[(1Z,5E,7Z)-6-fluoro-4-methyldeca-1,5,7-trienyl]hydroxylamine |
| SMILES | C=C(C)/N=C(\N)C(=O)NCCCn1ccnc1.CC/C=C\C(F)=C/C(C)C/C=C\ON |
| InChI | InChI=1S/C11H18FNO.C11H17N5O/c1-3-4-7-11(12)9-10(2)6-5-8-14-13;1-9(2)15-10(12)11(17)14-4-3-6-16-7-5-13-8-16/h4-5,7-10H,3,6,13H2,1-2H3;5,7-8H,1,3-4,6H2,2H3,(H2,12,15)(H,14,17)/b7-4-,8-5-,11-9+; |
| InChIKey | XQFAGDRXMYIJFP-SPAPVVPNSA-N |
| XLogP | 3.52 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|