About 5-(methylamino)isoindole-1,3-dione;propanal
5-(methylamino)isoindole-1,3-dione;propanal (PubChem CID 143040971) has the molecular formula C12H14N2O3
and a molecular weight of 234.25 g/mol. Its IUPAC name is 5-(methylamino)isoindole-1,3-dione;propanal.
Molecular Properties
| Compound Name | 5-(methylamino)isoindole-1,3-dione;propanal |
| PubChem CID | 143040971 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 5-(methylamino)isoindole-1,3-dione;propanal |
| SMILES | CCC=O.CNc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C9H8N2O2.C3H6O/c1-10-5-2-3-6-7(4-5)9(13)11-8(6)12;1-2-3-4/h2-4,10H,1H3,(H,11,12,13);3H,2H2,1H3 |
| InChIKey | PDRFHYHYJDEBOK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(methylamino)isoindole-1,3-dione;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylamino)isoindole-1,3-dione;propanal?
The IUPAC name of 5-(methylamino)isoindole-1,3-dione;propanal (CID 143040971) is 5-(methylamino)isoindole-1,3-dione;propanal.
What is the SMILES notation for 5-(methylamino)isoindole-1,3-dione;propanal?
The canonical SMILES for 5-(methylamino)isoindole-1,3-dione;propanal is CCC=O.CNc1ccc2c(c1)C(=O)NC2=O.
What is the InChIKey of 5-(methylamino)isoindole-1,3-dione;propanal?
The InChIKey is PDRFHYHYJDEBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2.C3H6O/c1-10-5-2-3-6-7(4-5)9(13)11-8(6)12;1-2-3-4/h2-4,10H,1H3,(H,11,12,13);3H,2H2,1H3.
What are the key properties of 5-(methylamino)isoindole-1,3-dione;propanal?
5-(methylamino)isoindole-1,3-dione;propanal has a molecular weight of 234.25 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylamino)isoindole-1,3-dione;propanal is sourced from PubChem (CID 143040971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).