About 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol
1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol (PubChem CID 143041041) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol.
Molecular Properties
| Compound Name | 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol |
| PubChem CID | 143041041 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol |
| SMILES | CC1=CC=C(O)C=CC1.CCOCCOC |
| InChI | InChI=1S/C8H10O.C5H12O2/c1-7-3-2-4-8(9)6-5-7;1-3-7-5-4-6-2/h2,4-6,9H,3H2,1H3;3-5H2,1-2H3 |
| InChIKey | AANNSIPUZUWNHT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol?
The IUPAC name of 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol (CID 143041041) is 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol.
What is the SMILES notation for 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol?
The canonical SMILES for 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol is CC1=CC=C(O)C=CC1.CCOCCOC.
What is the InChIKey of 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol?
The InChIKey is AANNSIPUZUWNHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C5H12O2/c1-7-3-2-4-8(9)6-5-7;1-3-7-5-4-6-2/h2,4-6,9H,3H2,1H3;3-5H2,1-2H3.
What are the key properties of 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol?
1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol has a molecular weight of 226.32 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2-methoxyethane;4-methylcyclohepta-1,3,6-trien-1-ol is sourced from PubChem (CID 143041041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).