C15H28F2N2O4 — CID 143041301
2-[[3-ethoxypropyl(ethyl)carbamoyl]amino]-4,4-difluoroheptanoic acid (PubChem CID 143041301) has the molecular formula C15H28F2N2O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-[[3-ethoxypropyl(ethyl)carbamoyl]amino]-4,4-difluoroheptanoic acid.
| Compound Name | 2-[[3-ethoxypropyl(ethyl)carbamoyl]amino]-4,4-difluoroheptanoic acid |
|---|---|
| PubChem CID | 143041301 |
| Molecular Formula | C15H28F2N2O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-[[3-ethoxypropyl(ethyl)carbamoyl]amino]-4,4-difluoroheptanoic acid |
| SMILES | CCCC(F)(F)CC(NC(=O)N(CC)CCCOCC)C(=O)O |
| InChI | InChI=1S/C15H28F2N2O4/c1-4-8-15(16,17)11-12(13(20)21)18-14(22)19(5-2)9-7-10-23-6-3/h12H,4-11H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | JPGOXHSQXOWLOK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|