C27H36N2O2 — CID 143041747
4-octyl-N-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]benzamide (PubChem CID 143041747) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 4-octyl-N-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]benzamide.
| Compound Name | 4-octyl-N-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 143041747 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 4-octyl-N-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]benzamide |
| SMILES | CCCCCCCCc1ccc(C(=O)NCC(=O)NC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C27H36N2O2/c1-2-3-4-5-6-7-11-21-16-18-23(19-17-21)27(31)28-20-26(30)29-25-15-10-13-22-12-8-9-14-24(22)25/h8-9,12,14,16-19,25H,2-7,10-11,13,15,20H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | UHYUMPWZCKHSQT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|