About 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide
3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide (PubChem CID 143041826) has the molecular formula C12H16F3NO
and a molecular weight of 247.26 g/mol. Its IUPAC name is 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide.
Molecular Properties
| Compound Name | 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide |
| PubChem CID | 143041826 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide |
| SMILES | CC(C)CC(=O)NC1C=C(C(F)(F)F)C=CC1 |
| InChI | InChI=1S/C12H16F3NO/c1-8(2)6-11(17)16-10-5-3-4-9(7-10)12(13,14)15/h3-4,7-8,10H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | XHTHQWQMCNHUNG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide?
The IUPAC name of 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide (CID 143041826) is 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide.
What is the SMILES notation for 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide?
The canonical SMILES for 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide is CC(C)CC(=O)NC1C=C(C(F)(F)F)C=CC1.
What is the InChIKey of 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide?
The InChIKey is XHTHQWQMCNHUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO/c1-8(2)6-11(17)16-10-5-3-4-9(7-10)12(13,14)15/h3-4,7-8,10H,5-6H2,1-2H3,(H,16,17).
What are the key properties of 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide?
3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide has a molecular weight of 247.26 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butanamide is sourced from PubChem (CID 143041826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).