C9H2Cl5N3O — CID 143041906
2,4-dichloro-6-(2,4,6-trichlorophenoxy)-1,3,5-triazine (PubChem CID 143041906) has the molecular formula C9H2Cl5N3O and a molecular weight of 345.40 g/mol. Its IUPAC name is 2,4-dichloro-6-(2,4,6-trichlorophenoxy)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(2,4,6-trichlorophenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 143041906 |
| Molecular Formula | C9H2Cl5N3O |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 342.86 |
| IUPAC Name | 2,4-dichloro-6-(2,4,6-trichlorophenoxy)-1,3,5-triazine |
| SMILES | Clc1cc(Cl)c(Oc2nc(Cl)nc(Cl)n2)c(Cl)c1 |
| InChI | InChI=1S/C9H2Cl5N3O/c10-3-1-4(11)6(5(12)2-3)18-9-16-7(13)15-8(14)17-9/h1-2H |
| InChIKey | RMWRJRWLKUDLPM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |