About ethane;2-(3-methylbutyl)aniline
ethane;2-(3-methylbutyl)aniline (PubChem CID 143042088) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is ethane;2-(3-methylbutyl)aniline.
Molecular Properties
| Compound Name | ethane;2-(3-methylbutyl)aniline |
| PubChem CID | 143042088 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | ethane;2-(3-methylbutyl)aniline |
| SMILES | CC.CC.CC(C)CCc1ccccc1N |
| InChI | InChI=1S/C11H17N.2C2H6/c1-9(2)7-8-10-5-3-4-6-11(10)12;2*1-2/h3-6,9H,7-8,12H2,1-2H3;2*1-2H3 |
| InChIKey | CFMXSGXCUDZYHQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(3-methylbutyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(3-methylbutyl)aniline?
The IUPAC name of ethane;2-(3-methylbutyl)aniline (CID 143042088) is ethane;2-(3-methylbutyl)aniline.
What is the SMILES notation for ethane;2-(3-methylbutyl)aniline?
The canonical SMILES for ethane;2-(3-methylbutyl)aniline is CC.CC.CC(C)CCc1ccccc1N.
What is the InChIKey of ethane;2-(3-methylbutyl)aniline?
The InChIKey is CFMXSGXCUDZYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.2C2H6/c1-9(2)7-8-10-5-3-4-6-11(10)12;2*1-2/h3-6,9H,7-8,12H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-(3-methylbutyl)aniline?
ethane;2-(3-methylbutyl)aniline has a molecular weight of 223.40 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(3-methylbutyl)aniline is sourced from PubChem (CID 143042088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).