C41H40N2O4P2 — CID 143042162
[(1Z,3Z)-1,2-bis(ethenyl)-4-[indol-1-yl(phenoxy)phosphanyl]oxy-3-methylpenta-1,3-dienoxy]-indol-1-yl-phenoxyphosphane;prop-1-ene (PubChem CID 143042162) has the molecular formula C41H40N2O4P2 and a molecular weight of 686.73 g/mol. Its IUPAC name is [(1Z,3Z)-1,2-bis(ethenyl)-4-[indol-1-yl(phenoxy)phosphanyl]oxy-3-methylpenta-1,3-dienoxy]-indol-1-yl-phenoxyphosphane;prop-1-ene.
| Compound Name | [(1Z,3Z)-1,2-bis(ethenyl)-4-[indol-1-yl(phenoxy)phosphanyl]oxy-3-methylpenta-1,3-dienoxy]-indol-1-yl-phenoxyphosphane;prop-1-ene |
|---|---|
| PubChem CID | 143042162 |
| Molecular Formula | C41H40N2O4P2 |
| Molecular Weight | 686.73 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | [(1Z,3Z)-1,2-bis(ethenyl)-4-[indol-1-yl(phenoxy)phosphanyl]oxy-3-methylpenta-1,3-dienoxy]-indol-1-yl-phenoxyphosphane;prop-1-ene |
| SMILES | C=C/C(OP(Oc1ccccc1)n1ccc2ccccc21)=C(C=C)/C(C)=C(/C)OP(Oc1ccccc1)n1ccc2ccccc21.C=CC |
| InChI | InChI=1S/C38H34N2O4P2.C3H6/c1-5-35(38(6-2)44-46(43-34-21-11-8-12-22-34)40-28-26-32-18-14-16-24-37(32)40)29(3)30(4)41-45(42-33-19-9-7-10-20-33)39-27-25-31-17-13-15-23-36(31)39;1-3-2/h5-28H,1-2H2,3-4H3;3H,1H2,2H3/b30-29-,38-35-; |
| InChIKey | FTQPLNFJGDTSOK-MYUUQPHDSA-N |
| XLogP | 12.75 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.73 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|