C16H22F3NS — CID 143043460
ethane;4-ethyl-2-[(3E,5Z)-8,8,8-trifluoro-7-methylocta-1,3,5-trien-4-yl]-1,3-thiazole (PubChem CID 143043460) has the molecular formula C16H22F3NS and a molecular weight of 317.42 g/mol. Its IUPAC name is ethane;4-ethyl-2-[(3E,5Z)-8,8,8-trifluoro-7-methylocta-1,3,5-trien-4-yl]-1,3-thiazole.
| Compound Name | ethane;4-ethyl-2-[(3E,5Z)-8,8,8-trifluoro-7-methylocta-1,3,5-trien-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 143043460 |
| Molecular Formula | C16H22F3NS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethane;4-ethyl-2-[(3E,5Z)-8,8,8-trifluoro-7-methylocta-1,3,5-trien-4-yl]-1,3-thiazole |
| SMILES | C=C/C=C(\C=C/C(C)C(F)(F)F)c1nc(CC)cs1.CC |
| InChI | InChI=1S/C14H16F3NS.C2H6/c1-4-6-11(8-7-10(3)14(15,16)17)13-18-12(5-2)9-19-13;1-2/h4,6-10H,1,5H2,2-3H3;1-2H3/b8-7-,11-6+; |
| InChIKey | NCHIWYBTWOOWSU-WUYYFAKCSA-N |
| XLogP | 6.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|