C13H18N2O — CID 143043509
2-ethyl-5-[(2E,4Z,6Z)-5-methylocta-2,4,6-trien-2-yl]-1,3,4-oxadiazole (PubChem CID 143043509) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-ethyl-5-[(2E,4Z,6Z)-5-methylocta-2,4,6-trien-2-yl]-1,3,4-oxadiazole.
| Compound Name | 2-ethyl-5-[(2E,4Z,6Z)-5-methylocta-2,4,6-trien-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143043509 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-ethyl-5-[(2E,4Z,6Z)-5-methylocta-2,4,6-trien-2-yl]-1,3,4-oxadiazole |
| SMILES | C/C=C\C(C)=C/C=C(\C)c1nnc(CC)o1 |
| InChI | InChI=1S/C13H18N2O/c1-5-7-10(3)8-9-11(4)13-15-14-12(6-2)16-13/h5,7-9H,6H2,1-4H3/b7-5-,10-8-,11-9+ |
| InChIKey | GPAYZDBRGZRMAD-IZYYEFCUSA-N |
| XLogP | 3.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|