About ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide
ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide (PubChem CID 143043738) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide.
Molecular Properties
| Compound Name | ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide |
| PubChem CID | 143043738 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide |
| SMILES | CC.CCCC(CCC)NC(=O)c1cc(C)c(C)o1 |
| InChI | InChI=1S/C14H23NO2.C2H6/c1-5-7-12(8-6-2)15-14(16)13-9-10(3)11(4)17-13;1-2/h9,12H,5-8H2,1-4H3,(H,15,16);1-2H3 |
| InChIKey | IJJFDGFBUGJCEZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide?
The IUPAC name of ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide (CID 143043738) is ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide.
What is the SMILES notation for ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide?
The canonical SMILES for ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide is CC.CCCC(CCC)NC(=O)c1cc(C)c(C)o1.
What is the InChIKey of ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide?
The InChIKey is IJJFDGFBUGJCEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO2.C2H6/c1-5-7-12(8-6-2)15-14(16)13-9-10(3)11(4)17-13;1-2/h9,12H,5-8H2,1-4H3,(H,15,16);1-2H3.
What are the key properties of ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide?
ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide has a molecular weight of 267.41 g/mol, XLogP of 4.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-heptan-4-yl-4,5-dimethylfuran-2-carboxamide is sourced from PubChem (CID 143043738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).