C14H22O5 — CID 143043823
methyl 2-[(3Z,5E)-5-(2-hydroxypropoxy)octa-1,3,5-trien-2-yl]oxyacetate (PubChem CID 143043823) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is methyl 2-[(3Z,5E)-5-(2-hydroxypropoxy)octa-1,3,5-trien-2-yl]oxyacetate.
| Compound Name | methyl 2-[(3Z,5E)-5-(2-hydroxypropoxy)octa-1,3,5-trien-2-yl]oxyacetate |
|---|---|
| PubChem CID | 143043823 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | methyl 2-[(3Z,5E)-5-(2-hydroxypropoxy)octa-1,3,5-trien-2-yl]oxyacetate |
| SMILES | C=C(/C=C\C(=C/CC)OCC(C)O)OCC(=O)OC |
| InChI | InChI=1S/C14H22O5/c1-5-6-13(19-9-11(2)15)8-7-12(3)18-10-14(16)17-4/h6-8,11,15H,3,5,9-10H2,1-2,4H3/b8-7-,13-6+ |
| InChIKey | UEDSEMBSAWFQRA-ZUKYEBQOSA-N |
| XLogP | 1.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|