C25H24N6OS — CID 143044002
7-[[6-[(2-phenylethylamino)methyl]-2-pyridinyl]methoxy]-2,4-dihydro-[1,2,4]triazino[3,4-a]phthalazine-3-thione (PubChem CID 143044002) has the molecular formula C25H24N6OS and a molecular weight of 456.58 g/mol. Its IUPAC name is 7-[[6-[(2-phenylethylamino)methyl]-2-pyridinyl]methoxy]-2,4-dihydro-[1,2,4]triazino[3,4-a]phthalazine-3-thione.
| Compound Name | 7-[[6-[(2-phenylethylamino)methyl]-2-pyridinyl]methoxy]-2,4-dihydro-[1,2,4]triazino[3,4-a]phthalazine-3-thione |
|---|---|
| PubChem CID | 143044002 |
| Molecular Formula | C25H24N6OS |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 7-[[6-[(2-phenylethylamino)methyl]-2-pyridinyl]methoxy]-2,4-dihydro-[1,2,4]triazino[3,4-a]phthalazine-3-thione |
| SMILES | S=C1CN2N=C(OCc3cccc(CNCCc4ccccc4)n3)c3ccccc3C2=NN1 |
| InChI | InChI=1S/C25H24N6OS/c33-23-16-31-24(29-28-23)21-11-4-5-12-22(21)25(30-31)32-17-20-10-6-9-19(27-20)15-26-14-13-18-7-2-1-3-8-18/h1-12,26H,13-17H2,(H,28,33) |
| InChIKey | KRUMAQWMUDYMHC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|