C30H25ClFN2O5S+ — CID 143044574
(5E)-5-[1-[3-chloro-4-[3-[2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxypropoxy]phenyl]ethylidene]-2-hydroxy-1,3-thiazol-3-ium-4-one (PubChem CID 143044574) has the molecular formula C30H25ClFN2O5S+ and a molecular weight of 580.06 g/mol. Its IUPAC name is (5E)-5-[1-[3-chloro-4-[3-[2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxypropoxy]phenyl]ethylidene]-2-hydroxy-1,3-thiazol-3-ium-4-one.
| Compound Name | (5E)-5-[1-[3-chloro-4-[3-[2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxypropoxy]phenyl]ethylidene]-2-hydroxy-1,3-thiazol-3-ium-4-one |
|---|---|
| PubChem CID | 143044574 |
| Molecular Formula | C30H25ClFN2O5S+ |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | (5E)-5-[1-[3-chloro-4-[3-[2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxypropoxy]phenyl]ethylidene]-2-hydroxy-1,3-thiazol-3-ium-4-one |
| SMILES | C/C(=C1\SC(O)=[NH+]C1=O)c1ccc(OCCCOc2c(-c3ccc(F)cc3)n(C)c3ccccc3c2=O)c(Cl)c1 |
| InChI | InChI=1S/C30H24ClFN2O5S/c1-17(28-29(36)33-30(37)40-28)19-10-13-24(22(31)16-19)38-14-5-15-39-27-25(18-8-11-20(32)12-9-18)34(2)23-7-4-3-6-21(23)26(27)35/h3-4,6-13,16H,5,14-15H2,1-2H3,(H,33,36,37)/p+1/b28-17+ |
| InChIKey | CCNYECQKZMHNBI-OGLMXYFKSA-O |
| XLogP | 4.84 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|