C21H39N3O — CID 143044697
2-(5-amino-2-methylphenyl)-4,5-dimethyl-4,5-dihydro-1H-pyrimidin-6-one;butane;ethane (PubChem CID 143044697) has the molecular formula C21H39N3O and a molecular weight of 349.56 g/mol. Its IUPAC name is 2-(5-amino-2-methylphenyl)-4,5-dimethyl-4,5-dihydro-1H-pyrimidin-6-one;butane;ethane.
| Compound Name | 2-(5-amino-2-methylphenyl)-4,5-dimethyl-4,5-dihydro-1H-pyrimidin-6-one;butane;ethane |
|---|---|
| PubChem CID | 143044697 |
| Molecular Formula | C21H39N3O |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | 2-(5-amino-2-methylphenyl)-4,5-dimethyl-4,5-dihydro-1H-pyrimidin-6-one;butane;ethane |
| SMILES | CC.CC.CCCC.Cc1ccc(N)cc1C1=NC(C)C(C)C(=O)N1 |
| InChI | InChI=1S/C13H17N3O.C4H10.2C2H6/c1-7-4-5-10(14)6-11(7)12-15-9(3)8(2)13(17)16-12;1-3-4-2;2*1-2/h4-6,8-9H,14H2,1-3H3,(H,15,16,17);3-4H2,1-2H3;2*1-2H3 |
| InChIKey | XCIFZQLIVLRACO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|