C13H25N2+ — CID 143046166
ethane;(1Z)-3-(4-methylpiperidin-1-ium-1-ylidene)penta-1,4-dien-1-amine (PubChem CID 143046166) has the molecular formula C13H25N2+ and a molecular weight of 209.36 g/mol. Its IUPAC name is ethane;(1Z)-3-(4-methylpiperidin-1-ium-1-ylidene)penta-1,4-dien-1-amine.
| Compound Name | ethane;(1Z)-3-(4-methylpiperidin-1-ium-1-ylidene)penta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 143046166 |
| Molecular Formula | C13H25N2+ |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.20 |
| IUPAC Name | ethane;(1Z)-3-(4-methylpiperidin-1-ium-1-ylidene)penta-1,4-dien-1-amine |
| SMILES | C=CC(/C=C\N)=[N+]1CCC(C)CC1.CC |
| InChI | InChI=1S/C11H18N2.C2H6/c1-3-11(4-7-12)13-8-5-10(2)6-9-13;1-2/h3-4,7,10,12H,1,5-6,8-9H2,2H3;1-2H3/p+1 |
| InChIKey | NJSWBUUUFVBYRR-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|