C26H35ClN4O — CID 143046864
(2E)-4-chloro-2-[(Z)-3-[5-(1-cyclohexa-1,5-dien-1-ylcyclopropyl)-4-methyl-1,2,4-triazol-3-yl]prop-1-enyl]-N,N-dipropylpenta-2,4-dienamide (PubChem CID 143046864) has the molecular formula C26H35ClN4O and a molecular weight of 455.05 g/mol. Its IUPAC name is (2E)-4-chloro-2-[(Z)-3-[5-(1-cyclohexa-1,5-dien-1-ylcyclopropyl)-4-methyl-1,2,4-triazol-3-yl]prop-1-enyl]-N,N-dipropylpenta-2,4-dienamide.
| Compound Name | (2E)-4-chloro-2-[(Z)-3-[5-(1-cyclohexa-1,5-dien-1-ylcyclopropyl)-4-methyl-1,2,4-triazol-3-yl]prop-1-enyl]-N,N-dipropylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 143046864 |
| Molecular Formula | C26H35ClN4O |
| Molecular Weight | 455.05 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (2E)-4-chloro-2-[(Z)-3-[5-(1-cyclohexa-1,5-dien-1-ylcyclopropyl)-4-methyl-1,2,4-triazol-3-yl]prop-1-enyl]-N,N-dipropylpenta-2,4-dienamide |
| SMILES | C=C(Cl)/C=C(\C=C/Cc1nnc(C2(C3=CCCC=C3)CC2)n1C)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C26H35ClN4O/c1-5-17-31(18-6-2)24(32)21(19-20(3)27)11-10-14-23-28-29-25(30(23)4)26(15-16-26)22-12-8-7-9-13-22/h8,10-13,19H,3,5-7,9,14-18H2,1-2,4H3/b11-10-,21-19+ |
| InChIKey | MQAPDTQBOLIXFZ-PEZIOFCTSA-N |
| XLogP | 5.55 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.05 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|