C23H39NO3 — CID 143046977
ethane;methane;methyl 9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylate (PubChem CID 143046977) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is ethane;methane;methyl 9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylate.
| Compound Name | ethane;methane;methyl 9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 143046977 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | ethane;methane;methyl 9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylate |
| SMILES | C.CC.COC(=O)C1CCC2C3CCC4NC(=O)C=CC4(C)C3CCC12C |
| InChI | InChI=1S/C20H29NO3.C2H6.CH4/c1-19-10-8-14-12(13(19)5-6-15(19)18(23)24-3)4-7-16-20(14,2)11-9-17(22)21-16;1-2;/h9,11-16H,4-8,10H2,1-3H3,(H,21,22);1-2H3;1H4 |
| InChIKey | FCLWFBIECUFDCH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |