About CID 143047011
CID 143047011 (PubChem CID 143047011) has the molecular formula C7H8N3
and a molecular weight of 134.16 g/mol.
Molecular Properties
| Compound Name | CID 143047011 |
| PubChem CID | 143047011 |
| Molecular Formula | C7H8N3 |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | — |
| SMILES | Cc1nc2c([nH]1)=CN[CH]C=2 |
| InChI | InChI=1S/C7H8N3/c1-5-9-6-2-3-8-4-7(6)10-5/h2-4,8H,1H3,(H,9,10) |
| InChIKey | YHGZYPHHHBCGID-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 143047011 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143047011?
The IUPAC name of CID 143047011 (CID 143047011) is not available.
What is the SMILES notation for CID 143047011?
The canonical SMILES for CID 143047011 is Cc1nc2c([nH]1)=CN[CH]C=2.
What is the InChIKey of CID 143047011?
The InChIKey is YHGZYPHHHBCGID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N3/c1-5-9-6-2-3-8-4-7(6)10-5/h2-4,8H,1H3,(H,9,10).
What are the key properties of CID 143047011?
CID 143047011 has a molecular weight of 134.16 g/mol, XLogP of -1.00, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143047011 is sourced from PubChem (CID 143047011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).