About 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane
9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane (PubChem CID 143047201) has the molecular formula C20H29NO2S
and a molecular weight of 347.52 g/mol. Its IUPAC name is 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane.
Molecular Properties
| Compound Name | 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane |
| PubChem CID | 143047201 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane |
| SMILES | CC.CC.CC1c2ccccc2-c2cc(S(N)(=O)=O)ccc2C1C |
| InChI | InChI=1S/C16H17NO2S.2C2H6/c1-10-11(2)14-8-7-12(20(17,18)19)9-16(14)15-6-4-3-5-13(10)15;2*1-2/h3-11H,1-2H3,(H2,17,18,19);2*1-2H3 |
| InChIKey | GXNZMKHZWSTUCH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane?
The IUPAC name of 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane (CID 143047201) is 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane.
What is the SMILES notation for 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane?
The canonical SMILES for 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane is CC.CC.CC1c2ccccc2-c2cc(S(N)(=O)=O)ccc2C1C.
What is the InChIKey of 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane?
The InChIKey is GXNZMKHZWSTUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2S.2C2H6/c1-10-11(2)14-8-7-12(20(17,18)19)9-16(14)15-6-4-3-5-13(10)15;2*1-2/h3-11H,1-2H3,(H2,17,18,19);2*1-2H3.
What are the key properties of 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane?
9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane has a molecular weight of 347.52 g/mol, XLogP of 5.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dimethyl-9,10-dihydrophenanthrene-3-sulfonamide;ethane is sourced from PubChem (CID 143047201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).