C18H27N3O2 — CID 143047297
N-(2-aminoethyl)-2-butoxyquinoline-4-carboxamide;ethane (PubChem CID 143047297) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-butoxyquinoline-4-carboxamide;ethane.
| Compound Name | N-(2-aminoethyl)-2-butoxyquinoline-4-carboxamide;ethane |
|---|---|
| PubChem CID | 143047297 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-(2-aminoethyl)-2-butoxyquinoline-4-carboxamide;ethane |
| SMILES | CC.CCCCOc1cc(C(=O)NCCN)c2ccccc2n1 |
| InChI | InChI=1S/C16H21N3O2.C2H6/c1-2-3-10-21-15-11-13(16(20)18-9-8-17)12-6-4-5-7-14(12)19-15;1-2/h4-7,11H,2-3,8-10,17H2,1H3,(H,18,20);1-2H3 |
| InChIKey | KYCBDLOXNCLPEG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|