About 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane
9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane (PubChem CID 143047720) has the molecular formula C14H11Cl2IN+
and a molecular weight of 391.06 g/mol. Its IUPAC name is 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane.
Molecular Properties
| Compound Name | 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane |
| PubChem CID | 143047720 |
| Molecular Formula | C14H11Cl2IN+ |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane |
| SMILES | CCl.Clc1ccc2c(I)cc3cccc[n+]3c2c1 |
| InChI | InChI=1S/C13H8ClIN.CH3Cl/c14-9-4-5-11-12(15)8-10-3-1-2-6-16(10)13(11)7-9;1-2/h1-8H;1H3/q+1; |
| InChIKey | PEHHZKPDBJWUBD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 4.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane?
The IUPAC name of 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane (CID 143047720) is 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane.
What is the SMILES notation for 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane?
The canonical SMILES for 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane is CCl.Clc1ccc2c(I)cc3cccc[n+]3c2c1.
What is the InChIKey of 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane?
The InChIKey is PEHHZKPDBJWUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClIN.CH3Cl/c14-9-4-5-11-12(15)8-10-3-1-2-6-16(10)13(11)7-9;1-2/h1-8H;1H3/q+1;.
What are the key properties of 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane?
9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane has a molecular weight of 391.06 g/mol, XLogP of 4.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-6-iodobenzo[c]quinolizin-11-ium;chloromethane is sourced from PubChem (CID 143047720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).