C18H26O2 — CID 143048254
(3Z,5E,7E)-2-ethoxy-7-ethyl-5-ethylidene-10-methylundeca-1,3,7,9-tetraen-6-one (PubChem CID 143048254) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (3Z,5E,7E)-2-ethoxy-7-ethyl-5-ethylidene-10-methylundeca-1,3,7,9-tetraen-6-one.
| Compound Name | (3Z,5E,7E)-2-ethoxy-7-ethyl-5-ethylidene-10-methylundeca-1,3,7,9-tetraen-6-one |
|---|---|
| PubChem CID | 143048254 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (3Z,5E,7E)-2-ethoxy-7-ethyl-5-ethylidene-10-methylundeca-1,3,7,9-tetraen-6-one |
| SMILES | C=C(/C=C\C(=C/C)C(=O)/C(=C/C=C(C)C)CC)OCC |
| InChI | InChI=1S/C18H26O2/c1-7-16(12-10-14(4)5)18(19)17(8-2)13-11-15(6)20-9-3/h8,10-13H,6-7,9H2,1-5H3/b13-11-,16-12+,17-8+ |
| InChIKey | KSCCVPUORFEECV-FHMOOKBOSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|