C12H19F — CID 143048353
(3E)-3-(2-fluoropropan-2-yl)-5,6-dimethylhepta-1,3,5-triene (PubChem CID 143048353) has the molecular formula C12H19F and a molecular weight of 182.28 g/mol. Its IUPAC name is (3E)-3-(2-fluoropropan-2-yl)-5,6-dimethylhepta-1,3,5-triene.
| Compound Name | (3E)-3-(2-fluoropropan-2-yl)-5,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143048353 |
| Molecular Formula | C12H19F |
| Molecular Weight | 182.28 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | (3E)-3-(2-fluoropropan-2-yl)-5,6-dimethylhepta-1,3,5-triene |
| SMILES | C=C/C(=C\C(C)=C(C)C)C(C)(C)F |
| InChI | InChI=1S/C12H19F/c1-7-11(12(5,6)13)8-10(4)9(2)3/h7-8H,1H2,2-6H3/b11-8+ |
| InChIKey | ONVTUVQSIWESNO-DHZHZOJOSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|